C31H26N2O6 — CID 23920498
(E,6R,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(4-hydroxynaphthalen-1-yl)-6-phenoxyhept-2-enoic acid (PubChem CID 23920498) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is (E,6R,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(4-hydroxynaphthalen-1-yl)-6-phenoxyhept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(4-hydroxynaphthalen-1-yl)-6-phenoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23920498 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (E,6R,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(4-hydroxynaphthalen-1-yl)-6-phenoxyhept-2-enoic acid |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](c2ccc(O)c3ccccc23)[C@@H](CC/C=C/C(=O)O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O6/c32-20-21-14-16-22(17-15-21)33-31(37)39-30(26-18-19-27(34)25-11-5-4-10-24(25)26)28(12-6-7-13-29(35)36)38-23-8-2-1-3-9-23/h1-5,7-11,13-19,28,30,34H,6,12H2,(H,33,37)(H,35,36)/b13-7+/t28-,30-/m1/s1 |
| InChIKey | QWYQVWIXTZCXFE-ZZKAXMNNSA-N |
| XLogP | 6.58 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|