C25H21IN4O4 — CID 23892607
[(E,1R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23892607) has the molecular formula C25H21IN4O4 and a molecular weight of 568.37 g/mol. Its IUPAC name is [(E,1R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23892607 |
| Molecular Formula | C25H21IN4O4 |
| Molecular Weight | 568.37 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | [(E,1R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](C/C=C/C(=O)Nc2ccccc2N)c2cc(I)ccc2O)cc1 |
| InChI | InChI=1S/C25H21IN4O4/c26-17-10-13-22(31)19(14-17)23(34-25(33)29-18-11-8-16(15-27)9-12-18)6-3-7-24(32)30-21-5-2-1-4-20(21)28/h1-5,7-14,23,31H,6,28H2,(H,29,33)(H,30,32)/b7-3+/t23-/m1/s1 |
| InChIKey | MKOWXOWWYMRHMC-WVKANMAXSA-N |
| XLogP | 5.33 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|