C25H27NO5S — CID 23749600
[(3R,4S)-4-(4-hydroxynaphthalen-1-yl)-3-methyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate (PubChem CID 23749600) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is [(3R,4S)-4-(4-hydroxynaphthalen-1-yl)-3-methyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4S)-4-(4-hydroxynaphthalen-1-yl)-3-methyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23749600 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | [(3R,4S)-4-(4-hydroxynaphthalen-1-yl)-3-methyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)O[C@H](c2ccc(O)c3ccccc23)[C@H](C)CCOC(=O)CS)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-16-7-9-18(10-8-16)26-25(29)31-24(17(2)13-14-30-23(28)15-32)21-11-12-22(27)20-6-4-3-5-19(20)21/h3-12,17,24,27,32H,13-15H2,1-2H3,(H,26,29)/t17-,24+/m1/s1 |
| InChIKey | JDFDCHJQABXNBB-OSPHWJPCSA-N |
| XLogP | 5.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|