C23H26BrNO7 — CID 23892902
(E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid (PubChem CID 23892902) has the molecular formula C23H26BrNO7 and a molecular weight of 508.37 g/mol. Its IUPAC name is (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23892902 |
| Molecular Formula | C23H26BrNO7 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
| SMILES | CO[C@H](CC/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C23H26BrNO7/c1-30-20(7-2-3-8-21(27)28)22(16-5-4-6-19(15-16)31-14-13-26)32-23(29)25-18-11-9-17(24)10-12-18/h3-6,8-12,15,20,22,26H,2,7,13-14H2,1H3,(H,25,29)(H,27,28)/b8-3+/t20-,22-/m1/s1 |
| InChIKey | BCYZDLZSULIDGT-DGEBXSHGSA-N |
| XLogP | 4.55 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|