C28H29N3O6 — CID 23892870
[(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23892870) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23892870 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](C/C=C/C(=O)Nc2ccccc2N)c2cccc(OCCO)c2)cc1 |
| InChI | InChI=1S/C28H29N3O6/c1-19(33)20-12-14-22(15-13-20)30-28(35)37-26(21-6-4-7-23(18-21)36-17-16-32)10-5-11-27(34)31-25-9-3-2-8-24(25)29/h2-9,11-15,18,26,32H,10,16-17,29H2,1H3,(H,30,35)(H,31,34)/b11-5+/t26-/m0/s1 |
| InChIKey | CPYAUGXNBNNAIB-OKZAPEIBSA-N |
| XLogP | 4.72 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|