C31H35N3O6 — CID 23865130
[(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23865130) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23865130 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](c2cccc(OCCO)c2)[C@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C31H35N3O6/c1-21(8-3-6-13-29(37)34-28-12-5-4-11-27(28)32)30(24-9-7-10-26(20-24)39-19-18-35)40-31(38)33-25-16-14-23(15-17-25)22(2)36/h4-7,9-17,20-21,30,35H,3,8,18-19,32H2,1-2H3,(H,33,38)(H,34,37)/b13-6+/t21-,30-/m1/s1 |
| InChIKey | BHEXXBUXSDIZHK-WENNBLPWSA-N |
| XLogP | 5.74 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|