C30H33N3O6 — CID 23892374
[(E,1R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23892374) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23892374 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | COc1ccc([C@H](OC(=O)NC(=O)c2ccccc2)C(C)(C)CC/C=C/C(=O)Nc2ccccc2N)cc1O |
| InChI | InChI=1S/C30H33N3O6/c1-30(2,18-10-9-15-26(35)32-23-14-8-7-13-22(23)31)27(21-16-17-25(38-3)24(34)19-21)39-29(37)33-28(36)20-11-5-4-6-12-20/h4-9,11-17,19,27,34H,10,18,31H2,1-3H3,(H,32,35)(H,33,36,37)/b15-9+/t27-/m0/s1 |
| InChIKey | MNTMFATVEZXJFX-LQYYAUOTSA-N |
| XLogP | 5.59 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|