C21H26N2O4 — CID 23920857
(E,7R)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enamide (PubChem CID 23920857) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (E,7R)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enamide.
| Compound Name | (E,7R)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enamide |
|---|---|
| PubChem CID | 23920857 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (E,7R)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/CCC[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C21H26N2O4/c22-18-6-4-5-7-19(18)23-21(26)9-3-1-2-8-20(25)16-10-12-17(13-11-16)27-15-14-24/h3-7,9-13,20,24-25H,1-2,8,14-15,22H2,(H,23,26)/b9-3+/t20-/m1/s1 |
| InChIKey | JPHSNDYKABPRQS-AXPFDKOBSA-N |
| XLogP | 3.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|