C34H33N3O7 — CID 23948709
[(E,1R,2R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23948709) has the molecular formula C34H33N3O7 and a molecular weight of 595.65 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23948709 |
| Molecular Formula | C34H33N3O7 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@H](c2ccccc2OCCO)[C@@H](/C=C/C(=O)Nc2ccccc2N)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C34H33N3O7/c1-23(39)24-15-17-25(18-16-24)36-34(41)44-33(27-11-5-8-14-30(27)42-22-21-38)31(43-26-9-3-2-4-10-26)19-20-32(40)37-29-13-7-6-12-28(29)35/h2-20,31,33,38H,21-22,35H2,1H3,(H,36,41)(H,37,40)/b20-19+/t31-,33-/m1/s1 |
| InChIKey | ROCIHPSBHMDRRQ-KQXXCEFCSA-N |
| XLogP | 5.77 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|