C19H23NO5 — CID 23808265
[(1R)-4-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]butyl] N-phenylcarbamate (PubChem CID 23808265) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [(1R)-4-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]butyl] N-phenylcarbamate.
| Compound Name | [(1R)-4-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]butyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23808265 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(1R)-4-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]butyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H](CCCO)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C19H23NO5/c21-12-4-7-18(15-8-10-17(11-9-15)24-14-13-22)25-19(23)20-16-5-2-1-3-6-16/h1-3,5-6,8-11,18,21-22H,4,7,12-14H2,(H,20,23)/t18-/m1/s1 |
| InChIKey | HJDRLLGUHFMDMF-GOSISDBHSA-N |
| XLogP | 3.12 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |