C17H19NO4 — CID 23836660
[(1R)-4-hydroxy-1-(4-hydroxyphenyl)butyl] N-phenylcarbamate (PubChem CID 23836660) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(1R)-4-hydroxy-1-(4-hydroxyphenyl)butyl] N-phenylcarbamate.
| Compound Name | [(1R)-4-hydroxy-1-(4-hydroxyphenyl)butyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23836660 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [(1R)-4-hydroxy-1-(4-hydroxyphenyl)butyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H](CCCO)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H19NO4/c19-12-4-7-16(13-8-10-15(20)11-9-13)22-17(21)18-14-5-2-1-3-6-14/h1-3,5-6,8-11,16,19-20H,4,7,12H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | WAGIUHRDDYFSMV-MRXNPFEDSA-N |
| XLogP | 3.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |