C18H20N4O2S — CID 173314699
[4-(carbamothioylhydrazinylidene)-1-phenylbutyl] N-phenylcarbamate (PubChem CID 173314699) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is [4-(carbamothioylhydrazinylidene)-1-phenylbutyl] N-phenylcarbamate.
| Compound Name | [4-(carbamothioylhydrazinylidene)-1-phenylbutyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 173314699 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [4-(carbamothioylhydrazinylidene)-1-phenylbutyl] N-phenylcarbamate |
| SMILES | NC(=S)NN=CCCC(OC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O2S/c19-17(25)22-20-13-7-12-16(14-8-3-1-4-9-14)24-18(23)21-15-10-5-2-6-11-15/h1-6,8-11,13,16H,7,12H2,(H,21,23)(H3,19,22,25) |
| InChIKey | ORAXRLMIQNZPDY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|