C19H16Br2N2O6 — CID 23836400
[(E,1S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23836400) has the molecular formula C19H16Br2N2O6 and a molecular weight of 528.15 g/mol. Its IUPAC name is [(E,1S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23836400 |
| Molecular Formula | C19H16Br2N2O6 |
| Molecular Weight | 528.15 g/mol |
| Exact Mass | 525.94 |
| IUPAC Name | [(E,1S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | O=C(/C=C/C[C@H](OC(=O)NC(=O)c1ccccc1)c1cc(Br)cc(Br)c1O)NO |
| InChI | InChI=1S/C19H16Br2N2O6/c20-12-9-13(17(25)14(21)10-12)15(7-4-8-16(24)23-28)29-19(27)22-18(26)11-5-2-1-3-6-11/h1-6,8-10,15,25,28H,7H2,(H,23,24)(H,22,26,27)/b8-4+/t15-/m0/s1 |
| InChIKey | IVHUHZSFRXEFPY-LWUPOJRFSA-N |
| XLogP | 3.98 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|