C26H22Br2N4O4 — CID 23836414
[(E,1S,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23836414) has the molecular formula C26H22Br2N4O4 and a molecular weight of 614.29 g/mol. Its IUPAC name is [(E,1S,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23836414 |
| Molecular Formula | C26H22Br2N4O4 |
| Molecular Weight | 614.29 g/mol |
| Exact Mass | 612.00 |
| IUPAC Name | [(E,1S,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | C[C@@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C26H22Br2N4O4/c1-15(6-11-23(33)32-22-5-3-2-4-21(22)30)25(19-12-17(27)13-20(28)24(19)34)36-26(35)31-18-9-7-16(14-29)8-10-18/h2-13,15,25,34H,30H2,1H3,(H,31,35)(H,32,33)/b11-6+/t15-,25-/m0/s1 |
| InChIKey | GNAVOPJNENNKPL-YOGCPCMSSA-N |
| XLogP | 6.49 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.29 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|