C23H23NO3S — CID 23864438
[(1S,2R)-1-(4-hydroxynaphthalen-1-yl)-2-methylbut-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23864438) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [(1S,2R)-1-(4-hydroxynaphthalen-1-yl)-2-methylbut-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(1S,2R)-1-(4-hydroxynaphthalen-1-yl)-2-methylbut-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23864438 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(1S,2R)-1-(4-hydroxynaphthalen-1-yl)-2-methylbut-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | C=C[C@@H](C)[C@H](OC(=O)Nc1ccc(SC)cc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C23H23NO3S/c1-4-15(2)22(20-13-14-21(25)19-8-6-5-7-18(19)20)27-23(26)24-16-9-11-17(28-3)12-10-16/h4-15,22,25H,1H2,2-3H3,(H,24,26)/t15-,22+/m1/s1 |
| InChIKey | VWQYRDWTNOOAJU-QRQCRPRQSA-N |
| XLogP | 6.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|