C20H20Br2N2O6S — CID 23807797
[(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methoxy-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23807797) has the molecular formula C20H20Br2N2O6S and a molecular weight of 576.26 g/mol. Its IUPAC name is [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methoxy-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methoxy-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23807797 |
| Molecular Formula | C20H20Br2N2O6S |
| Molecular Weight | 576.26 g/mol |
| Exact Mass | 573.94 |
| IUPAC Name | [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methoxy-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CO[C@@H](/C=C/C(=O)NO)[C@@H](OC(=O)Nc1ccc(SC)cc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C20H20Br2N2O6S/c1-29-16(7-8-17(25)24-28)19(14-9-11(21)10-15(22)18(14)26)30-20(27)23-12-3-5-13(31-2)6-4-12/h3-10,16,19,26,28H,1-2H3,(H,23,27)(H,24,25)/b8-7+/t16-,19-/m0/s1 |
| InChIKey | ZRPNGKONAMFGTM-KRCKVYFQSA-N |
| XLogP | 5.01 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|