C23H27NO6 — CID 23779056
(E,7S)-7-[2-(2-hydroxyethoxy)phenyl]-7-[(4-methylphenyl)carbamoyloxy]hept-2-enoic acid (PubChem CID 23779056) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (E,7S)-7-[2-(2-hydroxyethoxy)phenyl]-7-[(4-methylphenyl)carbamoyloxy]hept-2-enoic acid.
| Compound Name | (E,7S)-7-[2-(2-hydroxyethoxy)phenyl]-7-[(4-methylphenyl)carbamoyloxy]hept-2-enoic acid |
|---|---|
| PubChem CID | 23779056 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (E,7S)-7-[2-(2-hydroxyethoxy)phenyl]-7-[(4-methylphenyl)carbamoyloxy]hept-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)O[C@@H](CCC/C=C/C(=O)O)c2ccccc2OCCO)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-17-11-13-18(14-12-17)24-23(28)30-21(9-3-2-4-10-22(26)27)19-7-5-6-8-20(19)29-16-15-25/h4-8,10-14,21,25H,2-3,9,15-16H2,1H3,(H,24,28)(H,26,27)/b10-4+/t21-/m0/s1 |
| InChIKey | QOJIWASEVAWPEF-TVIPLOHISA-N |
| XLogP | 4.47 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|