C22H22N2O7 — CID 23892856
(E,4S,5S)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enoic acid (PubChem CID 23892856) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is (E,4S,5S)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23892856 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (E,4S,5S)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enoic acid |
| SMILES | CO[C@@H](/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1ccccc1OCCO |
| InChI | InChI=1S/C22H22N2O7/c1-29-19(10-11-20(26)27)21(17-4-2-3-5-18(17)30-13-12-25)31-22(28)24-16-8-6-15(14-23)7-9-16/h2-11,19,21,25H,12-13H2,1H3,(H,24,28)(H,26,27)/b11-10+/t19-,21-/m0/s1 |
| InChIKey | DHWPAWZYGGZUCE-PSVQYUNKSA-N |
| XLogP | 2.87 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|