C21H20N2O6 — CID 23920884
(E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]pent-2-enoic acid (PubChem CID 23920884) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]pent-2-enoic acid.
| Compound Name | (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 23920884 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[2-(2-hydroxyethoxy)phenyl]pent-2-enoic acid |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](C/C=C/C(=O)O)c2ccccc2OCCO)cc1 |
| InChI | InChI=1S/C21H20N2O6/c22-14-15-8-10-16(11-9-15)23-21(27)29-19(6-3-7-20(25)26)17-4-1-2-5-18(17)28-13-12-24/h1-5,7-11,19,24H,6,12-13H2,(H,23,27)(H,25,26)/b7-3+/t19-/m1/s1 |
| InChIKey | DBNRTXTYMRQQAW-SXQCNTSWSA-N |
| XLogP | 3.25 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|