C14H19NO6 — CID 23892787
(E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enamide (PubChem CID 23892787) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enamide.
| Compound Name | (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enamide |
|---|---|
| PubChem CID | 23892787 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-4-methoxypent-2-enamide |
| SMILES | CO[C@H](/C=C/C(=O)NO)[C@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C14H19NO6/c1-20-12(6-7-13(17)15-19)14(18)10-2-4-11(5-3-10)21-9-8-16/h2-7,12,14,16,18-19H,8-9H2,1H3,(H,15,17)/b7-6+/t12-,14-/m1/s1 |
| InChIKey | NIHXIPGPJMUHOW-WQYAIIHGSA-N |
| XLogP | 0.17 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|