C25H34O7 — CID 54106076
2,6-dihydroxy-3,5-bis[4-(2-hydroxyethoxy)phenyl]-2,6-dimethylheptan-4-one (PubChem CID 54106076) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2,6-dihydroxy-3,5-bis[4-(2-hydroxyethoxy)phenyl]-2,6-dimethylheptan-4-one.
| Compound Name | 2,6-dihydroxy-3,5-bis[4-(2-hydroxyethoxy)phenyl]-2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 54106076 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 2,6-dihydroxy-3,5-bis[4-(2-hydroxyethoxy)phenyl]-2,6-dimethylheptan-4-one |
| SMILES | CC(C)(O)C(C(=O)C(c1ccc(OCCO)cc1)C(C)(C)O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C25H34O7/c1-24(2,29)21(17-5-9-19(10-6-17)31-15-13-26)23(28)22(25(3,4)30)18-7-11-20(12-8-18)32-16-14-27/h5-12,21-22,26-27,29-30H,13-16H2,1-4H3 |
| InChIKey | NDWDBJJUEAHSHF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |