C15H22O6 — CID 59696091
5-[4-(2-hydroxyethoxy)phenoxy]-2-(hydroxymethyl)-2-methylpentanoic acid (PubChem CID 59696091) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethoxy)phenoxy]-2-(hydroxymethyl)-2-methylpentanoic acid.
| Compound Name | 5-[4-(2-hydroxyethoxy)phenoxy]-2-(hydroxymethyl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 59696091 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[4-(2-hydroxyethoxy)phenoxy]-2-(hydroxymethyl)-2-methylpentanoic acid |
| SMILES | CC(CO)(CCCOc1ccc(OCCO)cc1)C(=O)O |
| InChI | InChI=1S/C15H22O6/c1-15(11-17,14(18)19)7-2-9-20-12-3-5-13(6-4-12)21-10-8-16/h3-6,16-17H,2,7-11H2,1H3,(H,18,19) |
| InChIKey | BTSGQDUNVIWXCR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|