C14H22O5 — CID 23976788
(1S,2S)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]butane-1,4-diol (PubChem CID 23976788) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (1S,2S)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]butane-1,4-diol.
| Compound Name | (1S,2S)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]butane-1,4-diol |
|---|---|
| PubChem CID | 23976788 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1S,2S)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]butane-1,4-diol |
| SMILES | CCO[C@@H](CCO)[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C14H22O5/c1-2-18-13(7-8-15)14(17)11-3-5-12(6-4-11)19-10-9-16/h3-6,13-17H,2,7-10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | FMCUVZLWFZCIEG-KBPBESRZSA-N |
| XLogP | 0.88 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |