C15H22O5S — CID 23808057
[(3R,4R)-4-hydroxy-4-[4-(2-hydroxyethoxy)phenyl]-3-methylbutyl] 2-sulfanylacetate (PubChem CID 23808057) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxy-4-[4-(2-hydroxyethoxy)phenyl]-3-methylbutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-hydroxy-4-[4-(2-hydroxyethoxy)phenyl]-3-methylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23808057 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [(3R,4R)-4-hydroxy-4-[4-(2-hydroxyethoxy)phenyl]-3-methylbutyl] 2-sulfanylacetate |
| SMILES | C[C@H](CCOC(=O)CS)[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C15H22O5S/c1-11(6-8-20-14(17)10-21)15(18)12-2-4-13(5-3-12)19-9-7-16/h2-5,11,15-16,18,21H,6-10H2,1H3/t11-,15-/m1/s1 |
| InChIKey | WMZOMWFAPRSUOF-IAQYHMDHSA-N |
| XLogP | 1.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|