C18H24O5 — CID 23846718
prop-2-enyl (E,5R,6R)-6-hydroxy-6-[4-(2-hydroxyethoxy)phenyl]-5-methylhex-2-enoate (PubChem CID 23846718) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is prop-2-enyl (E,5R,6R)-6-hydroxy-6-[4-(2-hydroxyethoxy)phenyl]-5-methylhex-2-enoate.
| Compound Name | prop-2-enyl (E,5R,6R)-6-hydroxy-6-[4-(2-hydroxyethoxy)phenyl]-5-methylhex-2-enoate |
|---|---|
| PubChem CID | 23846718 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | prop-2-enyl (E,5R,6R)-6-hydroxy-6-[4-(2-hydroxyethoxy)phenyl]-5-methylhex-2-enoate |
| SMILES | C=CCOC(=O)/C=C/C[C@@H](C)[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C18H24O5/c1-3-12-23-17(20)6-4-5-14(2)18(21)15-7-9-16(10-8-15)22-13-11-19/h3-4,6-10,14,18-19,21H,1,5,11-13H2,2H3/b6-4+/t14-,18-/m1/s1 |
| InChIKey | GBXAERLFLDJUDL-DBTGMAAUSA-N |
| XLogP | 2.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|