C17H24O4 — CID 58883205
3-phenoxypropyl (E,5R,6S)-6-hydroxy-5-methylhept-2-enoate (PubChem CID 58883205) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-phenoxypropyl (E,5R,6S)-6-hydroxy-5-methylhept-2-enoate.
| Compound Name | 3-phenoxypropyl (E,5R,6S)-6-hydroxy-5-methylhept-2-enoate |
|---|---|
| PubChem CID | 58883205 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-phenoxypropyl (E,5R,6S)-6-hydroxy-5-methylhept-2-enoate |
| SMILES | C[C@H](O)[C@H](C)C/C=C/C(=O)OCCCOc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-14(15(2)18)8-6-11-17(19)21-13-7-12-20-16-9-4-3-5-10-16/h3-6,9-11,14-15,18H,7-8,12-13H2,1-2H3/b11-6+/t14-,15+/m1/s1 |
| InChIKey | RMQUQZFDNAZYDF-WTMFUUHESA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|