C26H29F2NO7 — CID 23930543
prop-2-enyl (E,6S,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoate (PubChem CID 23930543) has the molecular formula C26H29F2NO7 and a molecular weight of 505.51 g/mol. Its IUPAC name is prop-2-enyl (E,6S,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoate.
| Compound Name | prop-2-enyl (E,6S,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoate |
|---|---|
| PubChem CID | 23930543 |
| Molecular Formula | C26H29F2NO7 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | prop-2-enyl (E,6S,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoate |
| SMILES | C=CCOC(=O)/C=C/CC[C@H](OC)[C@@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C26H29F2NO7/c1-3-15-35-24(31)7-5-4-6-23(33-2)25(18-8-11-20(12-9-18)34-16-14-30)36-26(32)29-22-13-10-19(27)17-21(22)28/h3,5,7-13,17,23,25,30H,1,4,6,14-16H2,2H3,(H,29,32)/b7-5+/t23-,25-/m0/s1 |
| InChIKey | KOFBIOQXELYWAF-DZWYYWGUSA-N |
| XLogP | 4.71 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|