C23H26F2N2O7 — CID 23789274
[(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-3,4-dimethyl-5-oxopent-3-enyl] N-(2,4-difluorophenyl)carbamate (PubChem CID 23789274) has the molecular formula C23H26F2N2O7 and a molecular weight of 480.46 g/mol. Its IUPAC name is [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-3,4-dimethyl-5-oxopent-3-enyl] N-(2,4-difluorophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-3,4-dimethyl-5-oxopent-3-enyl] N-(2,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 23789274 |
| Molecular Formula | C23H26F2N2O7 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-3,4-dimethyl-5-oxopent-3-enyl] N-(2,4-difluorophenyl)carbamate |
| SMILES | CO[C@H](/C(C)=C(\C)C(=O)NO)[C@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C23H26F2N2O7/c1-13(14(2)22(29)27-31)20(32-3)21(15-4-7-17(8-5-15)33-11-10-28)34-23(30)26-19-9-6-16(24)12-18(19)25/h4-9,12,20-21,28,31H,10-11H2,1-3H3,(H,26,30)(H,27,29)/b14-13+/t20-,21-/m1/s1 |
| InChIKey | CXQYFDSSCDXXRB-SVKRATOZSA-N |
| XLogP | 3.48 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|