C27H31F2NO6 — CID 23902585
ethyl (2E,4E,6R,7R)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-3,5,6-trimethylhepta-2,4-dienoate (PubChem CID 23902585) has the molecular formula C27H31F2NO6 and a molecular weight of 503.54 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7R)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-3,5,6-trimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7R)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-3,5,6-trimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 23902585 |
| Molecular Formula | C27H31F2NO6 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | ethyl (2E,4E,6R,7R)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]-3,5,6-trimethylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C(\C)[C@@H](C)[C@@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C27H31F2NO6/c1-5-34-25(32)15-17(2)14-18(3)19(4)26(20-6-9-22(10-7-20)35-13-12-31)36-27(33)30-24-11-8-21(28)16-23(24)29/h6-11,14-16,19,26,31H,5,12-13H2,1-4H3,(H,30,33)/b17-15+,18-14+/t19-,26-/m1/s1 |
| InChIKey | WZEWDXPMVPRVCW-KLQBGDPKSA-N |
| XLogP | 5.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|