C19H26O5 — CID 23760328
ethyl (2E,4E,8R)-8-hydroxy-8-[4-(2-hydroxyethoxy)phenyl]-3-methylocta-2,4-dienoate (PubChem CID 23760328) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl (2E,4E,8R)-8-hydroxy-8-[4-(2-hydroxyethoxy)phenyl]-3-methylocta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,8R)-8-hydroxy-8-[4-(2-hydroxyethoxy)phenyl]-3-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 23760328 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl (2E,4E,8R)-8-hydroxy-8-[4-(2-hydroxyethoxy)phenyl]-3-methylocta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/CC[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C19H26O5/c1-3-23-19(22)14-15(2)6-4-5-7-18(21)16-8-10-17(11-9-16)24-13-12-20/h4,6,8-11,14,18,20-21H,3,5,7,12-13H2,1-2H3/b6-4+,15-14+/t18-/m1/s1 |
| InChIKey | HTHJZHNOAQFPJI-CRZWYRQDSA-N |
| XLogP | 2.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|