C13H20O4S — CID 171874667
1-[4-(2-methoxyethoxy)phenyl]-4-sulfanylbutane-1,2-diol (PubChem CID 171874667) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)phenyl]-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-[4-(2-methoxyethoxy)phenyl]-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874667 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)phenyl]-4-sulfanylbutane-1,2-diol |
| SMILES | COCCOc1ccc(C(O)C(O)CCS)cc1 |
| InChI | InChI=1S/C13H20O4S/c1-16-7-8-17-11-4-2-10(3-5-11)13(15)12(14)6-9-18/h2-5,12-15,18H,6-9H2,1H3 |
| InChIKey | OECIMXYOXGUJRF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|