C11H16O4S — CID 171873963
1-(4-hydroxy-3-methoxyphenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873963) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873963 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCS)ccc1O |
| InChI | InChI=1S/C11H16O4S/c1-15-10-6-7(2-3-8(10)12)11(14)9(13)4-5-16/h2-3,6,9,11-14,16H,4-5H2,1H3 |
| InChIKey | NVUOOOATTWAJBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|