C18H22O6 — CID 10664426
(1S,2R)-1,2-bis(4-hydroxy-3-methoxyphenyl)butane-1,4-diol (PubChem CID 10664426) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1S,2R)-1,2-bis(4-hydroxy-3-methoxyphenyl)butane-1,4-diol.
| Compound Name | (1S,2R)-1,2-bis(4-hydroxy-3-methoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 10664426 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S,2R)-1,2-bis(4-hydroxy-3-methoxyphenyl)butane-1,4-diol |
| SMILES | COc1cc([C@@H](O)[C@H](CCO)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C18H22O6/c1-23-16-9-11(3-5-14(16)20)13(7-8-19)18(22)12-4-6-15(21)17(10-12)24-2/h3-6,9-10,13,18-22H,7-8H2,1-2H3/t13-,18-/m1/s1 |
| InChIKey | BTDSROBJFNXBKX-FZKQIMNGSA-N |
| XLogP | 2.31 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |