C12H15F3O3S — CID 171874969
4-sulfanyl-1-[4-(2,2,2-trifluoroethoxy)phenyl]butane-1,2-diol (PubChem CID 171874969) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-sulfanyl-1-[4-(2,2,2-trifluoroethoxy)phenyl]butane-1,2-diol.
| Compound Name | 4-sulfanyl-1-[4-(2,2,2-trifluoroethoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171874969 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-sulfanyl-1-[4-(2,2,2-trifluoroethoxy)phenyl]butane-1,2-diol |
| SMILES | OC(CCS)C(O)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O3S/c13-12(14,15)7-18-9-3-1-8(2-4-9)11(17)10(16)5-6-19/h1-4,10-11,16-17,19H,5-7H2 |
| InChIKey | IURCHEXVLBYMLA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|