C12H17F2NO2 — CID 84802854
2-amino-1-[4-(2,2-difluoropropoxy)phenyl]propan-1-ol (PubChem CID 84802854) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-amino-1-[4-(2,2-difluoropropoxy)phenyl]propan-1-ol.
| Compound Name | 2-amino-1-[4-(2,2-difluoropropoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 84802854 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-amino-1-[4-(2,2-difluoropropoxy)phenyl]propan-1-ol |
| SMILES | CC(N)C(O)c1ccc(OCC(C)(F)F)cc1 |
| InChI | InChI=1S/C12H17F2NO2/c1-8(15)11(16)9-3-5-10(6-4-9)17-7-12(2,13)14/h3-6,8,11,16H,7,15H2,1-2H3 |
| InChIKey | BPTJXYYHRLAVEN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |