C11H12F3NO4S — CID 171875056
1-[3-nitro-4-(trifluoromethyl)phenyl]-4-sulfanylbutane-1,2-diol (PubChem CID 171875056) has the molecular formula C11H12F3NO4S and a molecular weight of 311.28 g/mol. Its IUPAC name is 1-[3-nitro-4-(trifluoromethyl)phenyl]-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-[3-nitro-4-(trifluoromethyl)phenyl]-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171875056 |
| Molecular Formula | C11H12F3NO4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 1-[3-nitro-4-(trifluoromethyl)phenyl]-4-sulfanylbutane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(O)C(O)CCS)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO4S/c12-11(13,14)7-2-1-6(5-8(7)15(18)19)10(17)9(16)3-4-20/h1-2,5,9-10,16-17,20H,3-4H2 |
| InChIKey | DCUQXKJOQAMLFB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|