C10H13NO6 — CID 171872801
1-(4-hydroxy-3-nitrophenyl)butane-1,2,4-triol (PubChem CID 171872801) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is 1-(4-hydroxy-3-nitrophenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-hydroxy-3-nitrophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872801 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(4-hydroxy-3-nitrophenyl)butane-1,2,4-triol |
| SMILES | O=[N+]([O-])c1cc(C(O)C(O)CCO)ccc1O |
| InChI | InChI=1S/C10H13NO6/c12-4-3-9(14)10(15)6-1-2-8(13)7(5-6)11(16)17/h1-2,5,9-10,12-15H,3-4H2 |
| InChIKey | GQOMTKYLBGKHSJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|