C10H16ClN3O3 — CID 171199926
4-[(1R)-1,4-diaminobutyl]-2-nitrophenol;hydrochloride (PubChem CID 171199926) has the molecular formula C10H16ClN3O3 and a molecular weight of 261.71 g/mol. Its IUPAC name is 4-[(1R)-1,4-diaminobutyl]-2-nitrophenol;hydrochloride.
| Compound Name | 4-[(1R)-1,4-diaminobutyl]-2-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171199926 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-[(1R)-1,4-diaminobutyl]-2-nitrophenol;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H15N3O3.ClH/c11-5-1-2-8(12)7-3-4-10(14)9(6-7)13(15)16;/h3-4,6,8,14H,1-2,5,11-12H2;1H/t8-;/m1./s1 |
| InChIKey | MIALVJYNPAPXLZ-DDWIOCJRSA-N |
| XLogP | 1.46 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|