C11H13NO5S — CID 171874800
5-(1,2-dihydroxy-4-sulfanylbutyl)-2-nitrobenzaldehyde (PubChem CID 171874800) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-4-sulfanylbutyl)-2-nitrobenzaldehyde.
| Compound Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)-2-nitrobenzaldehyde |
|---|---|
| PubChem CID | 171874800 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)-2-nitrobenzaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CCS)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO5S/c13-6-8-5-7(1-2-9(8)12(16)17)11(15)10(14)3-4-18/h1-2,5-6,10-11,14-15,18H,3-4H2 |
| InChIKey | NSBFYWYTVXYWKQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|