C11H13ClF3NO3 — CID 171894727
4-chloro-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]butane-1,2-diol (PubChem CID 171894727) has the molecular formula C11H13ClF3NO3 and a molecular weight of 299.68 g/mol. Its IUPAC name is 4-chloro-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]butane-1,2-diol.
| Compound Name | 4-chloro-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171894727 |
| Molecular Formula | C11H13ClF3NO3 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-chloro-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H13ClF3NO3/c12-4-3-8(17)10(18)7-1-2-9(16-5-7)19-6-11(13,14)15/h1-2,5,8,10,17-18H,3-4,6H2 |
| InChIKey | AIVAJDUFHCYFMO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|