C10H11BrF3NO3 — CID 171860909
3-bromo-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propane-1,2-diol (PubChem CID 171860909) has the molecular formula C10H11BrF3NO3 and a molecular weight of 330.10 g/mol. Its IUPAC name is 3-bromo-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propane-1,2-diol.
| Compound Name | 3-bromo-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171860909 |
| Molecular Formula | C10H11BrF3NO3 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 3-bromo-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H11BrF3NO3/c11-3-7(16)9(17)6-1-2-8(15-4-6)18-5-10(12,13)14/h1-2,4,7,9,16-17H,3,5H2 |
| InChIKey | VHKZMMOCXOGZFH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|