C20H28N2O4 — CID 101255138
1,2-bis[4-(2-methoxyethoxy)phenyl]ethane-1,2-diamine (PubChem CID 101255138) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1,2-bis[4-(2-methoxyethoxy)phenyl]ethane-1,2-diamine.
| Compound Name | 1,2-bis[4-(2-methoxyethoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 101255138 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1,2-bis[4-(2-methoxyethoxy)phenyl]ethane-1,2-diamine |
| SMILES | COCCOc1ccc(C(N)C(N)c2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-23-11-13-25-17-7-3-15(4-8-17)19(21)20(22)16-5-9-18(10-6-16)26-14-12-24-2/h3-10,19-20H,11-14,21-22H2,1-2H3 |
| InChIKey | VBSPDDMAFMRFRE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|