C30H48N2O8 — CID 101191094
(1R,2R)-1,2-bis[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 101191094) has the molecular formula C30H48N2O8 and a molecular weight of 564.72 g/mol. Its IUPAC name is (1R,2R)-1,2-bis[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | (1R,2R)-1,2-bis[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 101191094 |
| Molecular Formula | C30H48N2O8 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | (1R,2R)-1,2-bis[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN[C@H](c1ccc(OCCOCCOCCOC)cc1)[C@H](NC)c1ccc(OCCOCCOCCOC)cc1 |
| InChI | InChI=1S/C30H48N2O8/c1-31-29(25-5-9-27(10-6-25)39-23-21-37-19-17-35-15-13-33-3)30(32-2)26-7-11-28(12-8-26)40-24-22-38-20-18-36-16-14-34-4/h5-12,29-32H,13-24H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | OGLXYQTWLJQWNO-LOYHVIPDSA-N |
| XLogP | 3.02 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|