C22H22FNO6 — CID 23892658
(E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(3-fluoro-4-hydroxyphenyl)-6-methylhept-2-enoic acid (PubChem CID 23892658) has the molecular formula C22H22FNO6 and a molecular weight of 415.42 g/mol. Its IUPAC name is (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(3-fluoro-4-hydroxyphenyl)-6-methylhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(3-fluoro-4-hydroxyphenyl)-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 23892658 |
| Molecular Formula | C22H22FNO6 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(3-fluoro-4-hydroxyphenyl)-6-methylhept-2-enoic acid |
| SMILES | C[C@@H](CC/C=C/C(=O)O)[C@H](OC(=O)NC(=O)c1ccccc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C22H22FNO6/c1-14(7-5-6-10-19(26)27)20(16-11-12-18(25)17(23)13-16)30-22(29)24-21(28)15-8-3-2-4-9-15/h2-4,6,8-14,20,25H,5,7H2,1H3,(H,26,27)(H,24,28,29)/b10-6+/t14-,20-/m0/s1 |
| InChIKey | JNAHUTRGIYDYBM-IZVTWGEESA-N |
| XLogP | 4.20 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|