C13H15BrO5 — CID 23920367
(E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-4-ethoxy-5-hydroxypent-2-enoic acid (PubChem CID 23920367) has the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. Its IUPAC name is (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-4-ethoxy-5-hydroxypent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-4-ethoxy-5-hydroxypent-2-enoic acid |
|---|---|
| PubChem CID | 23920367 |
| Molecular Formula | C13H15BrO5 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-4-ethoxy-5-hydroxypent-2-enoic acid |
| SMILES | CCO[C@H](/C=C/C(=O)O)[C@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H15BrO5/c1-2-19-11(5-6-12(16)17)13(18)9-7-8(14)3-4-10(9)15/h3-7,11,13,15,18H,2H2,1H3,(H,16,17)/b6-5+/t11-,13-/m1/s1 |
| InChIKey | FKSHGZQLNCAWFX-ZFAUCMQBSA-N |
| XLogP | 2.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|