C10H11IO5 — CID 89099387
3-hydroxy-3-[4-hydroxy-3-(iodomethoxy)phenyl]propanoic acid (PubChem CID 89099387) has the molecular formula C10H11IO5 and a molecular weight of 338.10 g/mol. Its IUPAC name is 3-hydroxy-3-[4-hydroxy-3-(iodomethoxy)phenyl]propanoic acid.
| Compound Name | 3-hydroxy-3-[4-hydroxy-3-(iodomethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 89099387 |
| Molecular Formula | C10H11IO5 |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 3-hydroxy-3-[4-hydroxy-3-(iodomethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CC(O)c1ccc(O)c(OCI)c1 |
| InChI | InChI=1S/C10H11IO5/c11-5-16-9-3-6(1-2-7(9)12)8(13)4-10(14)15/h1-3,8,12-13H,4-5H2,(H,14,15) |
| InChIKey | IOHJNRFPOFPREF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|