C23H22O5 — CID 142645838
3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid (PubChem CID 142645838) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid.
| Compound Name | 3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142645838 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid |
| SMILES | O=C(O)CC(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22O5/c24-20(14-23(25)26)19-11-12-21(27-15-17-7-3-1-4-8-17)22(13-19)28-16-18-9-5-2-6-10-18/h1-13,20,24H,14-16H2,(H,25,26) |
| InChIKey | FKHSCJKVCFGYDB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |