C30H27NO6 — CID 54568424
(2S)-2-benzamido-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid (PubChem CID 54568424) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is (2S)-2-benzamido-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-benzamido-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 54568424 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (2S)-2-benzamido-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid |
| SMILES | O=C(N[C@H](C(=O)O)C(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO6/c32-28(27(30(34)35)31-29(33)23-14-8-3-9-15-23)24-16-17-25(36-19-21-10-4-1-5-11-21)26(18-24)37-20-22-12-6-2-7-13-22/h1-18,27-28,32H,19-20H2,(H,31,33)(H,34,35)/t27-,28?/m0/s1 |
| InChIKey | ZVMOPHBSJZNQJO-MBMZGMDYSA-N |
| XLogP | 4.76 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |