C20H20ClNO6 — CID 11429645
(2S,3R)-3-(3-chloro-4-phenylmethoxyphenyl)-3-hydroxy-2-(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 11429645) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is (2S,3R)-3-(3-chloro-4-phenylmethoxyphenyl)-3-hydroxy-2-(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | (2S,3R)-3-(3-chloro-4-phenylmethoxyphenyl)-3-hydroxy-2-(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 11429645 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2S,3R)-3-(3-chloro-4-phenylmethoxyphenyl)-3-hydroxy-2-(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)N[C@H](C(=O)O)[C@H](O)c1ccc(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO6/c1-2-10-27-20(26)22-17(19(24)25)18(23)14-8-9-16(15(21)11-14)28-12-13-6-4-3-5-7-13/h2-9,11,17-18,23H,1,10,12H2,(H,22,26)(H,24,25)/t17-,18+/m0/s1 |
| InChIKey | JBSMIPZWWTXTLL-ZWKOTPCHSA-N |
| XLogP | 3.32 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|