C16H13Cl3N2O5 — CID 125457587
(2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)-3-(2,4,6-trichloro-3-pyridinyl)propanoic acid (PubChem CID 125457587) has the molecular formula C16H13Cl3N2O5 and a molecular weight of 419.65 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)-3-(2,4,6-trichloro-3-pyridinyl)propanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)-3-(2,4,6-trichloro-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 125457587 |
| Molecular Formula | C16H13Cl3N2O5 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)-3-(2,4,6-trichloro-3-pyridinyl)propanoic acid |
| SMILES | O=C(N[C@H](C(=O)O)[C@@H](O)c1c(Cl)cc(Cl)nc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C16H13Cl3N2O5/c17-9-6-10(18)20-14(19)11(9)13(22)12(15(23)24)21-16(25)26-7-8-4-2-1-3-5-8/h1-6,12-13,22H,7H2,(H,21,25)(H,23,24)/t12-,13-/m0/s1 |
| InChIKey | LJEMCMRLVJZVLM-STQMWFEESA-N |
| XLogP | 3.45 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|